About 3-hydroxybenzaldehyde;methoxymethane
3-hydroxybenzaldehyde;methoxymethane (PubChem CID 163225851) has the molecular formula C9H12O3
and a molecular weight of 168.19 g/mol. Its IUPAC name is 3-hydroxybenzaldehyde;methoxymethane.
Molecular Properties
| Compound Name | 3-hydroxybenzaldehyde;methoxymethane |
| PubChem CID | 163225851 |
| Molecular Formula | C9H12O3 |
| Molecular Weight | 168.19 g/mol |
| Exact Mass | 168.08 |
| IUPAC Name | 3-hydroxybenzaldehyde;methoxymethane |
| SMILES | COC.O=Cc1cccc(O)c1 |
| InChI | InChI=1S/C7H6O2.C2H6O/c8-5-6-2-1-3-7(9)4-6;1-3-2/h1-5,9H;1-2H3 |
| InChIKey | ZUKHZZWAHVJGHP-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.19 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 3-hydroxybenzaldehyde;methoxymethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-hydroxybenzaldehyde;methoxymethane?
The IUPAC name of 3-hydroxybenzaldehyde;methoxymethane (CID 163225851) is 3-hydroxybenzaldehyde;methoxymethane.
What is the SMILES notation for 3-hydroxybenzaldehyde;methoxymethane?
The canonical SMILES for 3-hydroxybenzaldehyde;methoxymethane is COC.O=Cc1cccc(O)c1.
What is the InChIKey of 3-hydroxybenzaldehyde;methoxymethane?
The InChIKey is ZUKHZZWAHVJGHP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6O2.C2H6O/c8-5-6-2-1-3-7(9)4-6;1-3-2/h1-5,9H;1-2H3.
What are the key properties of 3-hydroxybenzaldehyde;methoxymethane?
3-hydroxybenzaldehyde;methoxymethane has a molecular weight of 168.19 g/mol, XLogP of 1.47, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hydroxybenzaldehyde;methoxymethane is sourced from PubChem (CID 163225851), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).