About 2-bromo-5-hydroxybenzaldehyde;3-hydroxybenzaldehyde;molecular bromine
2-bromo-5-hydroxybenzaldehyde;3-hydroxybenzaldehyde;molecular bromine (PubChem CID 162110938) has the molecular formula C14H11Br3O4
and a molecular weight of 482.95 g/mol. Its IUPAC name is 2-bromo-5-hydroxybenzaldehyde;3-hydroxybenzaldehyde;molecular bromine.
Molecular Properties
| Compound Name | 2-bromo-5-hydroxybenzaldehyde;3-hydroxybenzaldehyde;molecular bromine |
| PubChem CID | 162110938 |
| Molecular Formula | C14H11Br3O4 |
| Molecular Weight | 482.95 g/mol |
| Exact Mass | 479.82 |
| IUPAC Name | 2-bromo-5-hydroxybenzaldehyde;3-hydroxybenzaldehyde;molecular bromine |
| SMILES | BrBr.O=Cc1cc(O)ccc1Br.O=Cc1cccc(O)c1 |
| InChI | InChI=1S/C7H5BrO2.C7H6O2.Br2/c8-7-2-1-6(10)3-5(7)4-9;8-5-6-2-1-3-7(9)4-6;1-2/h1-4,10H;1-5,9H; |
| InChIKey | ZGDJSDRSHZXBDI-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 482.95 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-bromo-5-hydroxybenzaldehyde;3-hydroxybenzaldehyde;molecular bromine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-5-hydroxybenzaldehyde;3-hydroxybenzaldehyde;molecular bromine?
The IUPAC name of 2-bromo-5-hydroxybenzaldehyde;3-hydroxybenzaldehyde;molecular bromine (CID 162110938) is 2-bromo-5-hydroxybenzaldehyde;3-hydroxybenzaldehyde;molecular bromine.
What is the SMILES notation for 2-bromo-5-hydroxybenzaldehyde;3-hydroxybenzaldehyde;molecular bromine?
The canonical SMILES for 2-bromo-5-hydroxybenzaldehyde;3-hydroxybenzaldehyde;molecular bromine is BrBr.O=Cc1cc(O)ccc1Br.O=Cc1cccc(O)c1.
What is the InChIKey of 2-bromo-5-hydroxybenzaldehyde;3-hydroxybenzaldehyde;molecular bromine?
The InChIKey is ZGDJSDRSHZXBDI-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5BrO2.C7H6O2.Br2/c8-7-2-1-6(10)3-5(7)4-9;8-5-6-2-1-3-7(9)4-6;1-2/h1-4,10H;1-5,9H;.
What are the key properties of 2-bromo-5-hydroxybenzaldehyde;3-hydroxybenzaldehyde;molecular bromine?
2-bromo-5-hydroxybenzaldehyde;3-hydroxybenzaldehyde;molecular bromine has a molecular weight of 482.95 g/mol, XLogP of 4.86, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-5-hydroxybenzaldehyde;3-hydroxybenzaldehyde;molecular bromine is sourced from PubChem (CID 162110938), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).