C22H29Br2ClN2O4 — CID 160902617
2-bromo-5-[2-(dimethylamino)ethoxy]benzaldehyde;2-bromo-5-hydroxybenzaldehyde;2-chloro-N,N-dimethylethanamine (PubChem CID 160902617) has the molecular formula C22H29Br2ClN2O4 and a molecular weight of 580.75 g/mol. Its IUPAC name is 2-bromo-5-[2-(dimethylamino)ethoxy]benzaldehyde;2-bromo-5-hydroxybenzaldehyde;2-chloro-N,N-dimethylethanamine.
| Compound Name | 2-bromo-5-[2-(dimethylamino)ethoxy]benzaldehyde;2-bromo-5-hydroxybenzaldehyde;2-chloro-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 160902617 |
| Molecular Formula | C22H29Br2ClN2O4 |
| Molecular Weight | 580.75 g/mol |
| Exact Mass | 578.02 |
| IUPAC Name | 2-bromo-5-[2-(dimethylamino)ethoxy]benzaldehyde;2-bromo-5-hydroxybenzaldehyde;2-chloro-N,N-dimethylethanamine |
| SMILES | CN(C)CCCl.CN(C)CCOc1ccc(Br)c(C=O)c1.O=Cc1cc(O)ccc1Br |
| InChI | InChI=1S/C11H14BrNO2.C7H5BrO2.C4H10ClN/c1-13(2)5-6-15-10-3-4-11(12)9(7-10)8-14;8-7-2-1-6(10)3-5(7)4-9;1-6(2)4-3-5/h3-4,7-8H,5-6H2,1-2H3;1-4,10H;3-4H2,1-2H3 |
| InChIKey | SPSBVTHHHHFERD-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.75 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|