C24H24BrNO4 — CID 90755566
2-[3-bromo-5-(hydroxymethyl)-2-(4-hydroxyphenyl)phenyl]-4-[2-(dimethylamino)ethoxy]benzaldehyde (PubChem CID 90755566) has the molecular formula C24H24BrNO4 and a molecular weight of 470.36 g/mol. Its IUPAC name is 2-[3-bromo-5-(hydroxymethyl)-2-(4-hydroxyphenyl)phenyl]-4-[2-(dimethylamino)ethoxy]benzaldehyde.
| Compound Name | 2-[3-bromo-5-(hydroxymethyl)-2-(4-hydroxyphenyl)phenyl]-4-[2-(dimethylamino)ethoxy]benzaldehyde |
|---|---|
| PubChem CID | 90755566 |
| Molecular Formula | C24H24BrNO4 |
| Molecular Weight | 470.36 g/mol |
| Exact Mass | 469.09 |
| IUPAC Name | 2-[3-bromo-5-(hydroxymethyl)-2-(4-hydroxyphenyl)phenyl]-4-[2-(dimethylamino)ethoxy]benzaldehyde |
| SMILES | CN(C)CCOc1ccc(C=O)c(-c2cc(CO)cc(Br)c2-c2ccc(O)cc2)c1 |
| InChI | InChI=1S/C24H24BrNO4/c1-26(2)9-10-30-20-8-5-18(15-28)21(13-20)22-11-16(14-27)12-23(25)24(22)17-3-6-19(29)7-4-17/h3-8,11-13,15,27,29H,9-10,14H2,1-2H3 |
| InChIKey | DODLXBLMEJQONU-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.36 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|