C12H14BrNO4 — CID 81494620
2-(4-bromo-3-formylphenoxy)-N-(2-methoxyethyl)acetamide (PubChem CID 81494620) has the molecular formula C12H14BrNO4 and a molecular weight of 316.15 g/mol. Its IUPAC name is 2-(4-bromo-3-formylphenoxy)-N-(2-methoxyethyl)acetamide.
| Compound Name | 2-(4-bromo-3-formylphenoxy)-N-(2-methoxyethyl)acetamide |
|---|---|
| PubChem CID | 81494620 |
| Molecular Formula | C12H14BrNO4 |
| Molecular Weight | 316.15 g/mol |
| Exact Mass | 315.01 |
| IUPAC Name | 2-(4-bromo-3-formylphenoxy)-N-(2-methoxyethyl)acetamide |
| SMILES | COCCNC(=O)COc1ccc(Br)c(C=O)c1 |
| InChI | InChI=1S/C12H14BrNO4/c1-17-5-4-14-12(16)8-18-10-2-3-11(13)9(6-10)7-15/h2-3,6-7H,4-5,8H2,1H3,(H,14,16) |
| InChIKey | AMUXDPNKGVDCNH-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.15 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|