C15H23NO4 — CID 4733178
2-(3-butoxyphenoxy)-N-(2-methoxyethyl)acetamide (PubChem CID 4733178) has the molecular formula C15H23NO4 and a molecular weight of 281.35 g/mol. Its IUPAC name is 2-(3-butoxyphenoxy)-N-(2-methoxyethyl)acetamide.
| Compound Name | 2-(3-butoxyphenoxy)-N-(2-methoxyethyl)acetamide |
|---|---|
| PubChem CID | 4733178 |
| Molecular Formula | C15H23NO4 |
| Molecular Weight | 281.35 g/mol |
| Exact Mass | 281.16 |
| IUPAC Name | 2-(3-butoxyphenoxy)-N-(2-methoxyethyl)acetamide |
| SMILES | CCCCOc1cccc(OCC(=O)NCCOC)c1 |
| InChI | InChI=1S/C15H23NO4/c1-3-4-9-19-13-6-5-7-14(11-13)20-12-15(17)16-8-10-18-2/h5-7,11H,3-4,8-10,12H2,1-2H3,(H,16,17) |
| InChIKey | GPJBSGXLYUPJDC-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.35 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|