C16H26N2O3 — CID 4733113
N-[3-(dimethylamino)propyl]-2-(3-propoxyphenoxy)acetamide (PubChem CID 4733113) has the molecular formula C16H26N2O3 and a molecular weight of 294.39 g/mol. Its IUPAC name is N-[3-(dimethylamino)propyl]-2-(3-propoxyphenoxy)acetamide.
| Compound Name | N-[3-(dimethylamino)propyl]-2-(3-propoxyphenoxy)acetamide |
|---|---|
| PubChem CID | 4733113 |
| Molecular Formula | C16H26N2O3 |
| Molecular Weight | 294.39 g/mol |
| Exact Mass | 294.19 |
| IUPAC Name | N-[3-(dimethylamino)propyl]-2-(3-propoxyphenoxy)acetamide |
| SMILES | CCCOc1cccc(OCC(=O)NCCCN(C)C)c1 |
| InChI | InChI=1S/C16H26N2O3/c1-4-11-20-14-7-5-8-15(12-14)21-13-16(19)17-9-6-10-18(2)3/h5,7-8,12H,4,6,9-11,13H2,1-3H3,(H,17,19) |
| InChIKey | UHJHLXNYGFXEFX-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.39 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|