About 3-bromobenzaldehyde;ethane
3-bromobenzaldehyde;ethane (PubChem CID 91121301) has the molecular formula C9H11BrO
and a molecular weight of 215.09 g/mol. Its IUPAC name is 3-bromobenzaldehyde;ethane.
Molecular Properties
| Compound Name | 3-bromobenzaldehyde;ethane |
| PubChem CID | 91121301 |
| Molecular Formula | C9H11BrO |
| Molecular Weight | 215.09 g/mol |
| Exact Mass | 214.00 |
| IUPAC Name | 3-bromobenzaldehyde;ethane |
| SMILES | CC.O=Cc1cccc(Br)c1 |
| InChI | InChI=1S/C7H5BrO.C2H6/c8-7-3-1-2-6(4-7)5-9;1-2/h1-5H;1-2H3 |
| InChIKey | IPJWOKGMVORSAT-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.09 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 3-bromobenzaldehyde;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromobenzaldehyde;ethane?
The IUPAC name of 3-bromobenzaldehyde;ethane (CID 91121301) is 3-bromobenzaldehyde;ethane.
What is the SMILES notation for 3-bromobenzaldehyde;ethane?
The canonical SMILES for 3-bromobenzaldehyde;ethane is CC.O=Cc1cccc(Br)c1.
What is the InChIKey of 3-bromobenzaldehyde;ethane?
The InChIKey is IPJWOKGMVORSAT-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5BrO.C2H6/c8-7-3-1-2-6(4-7)5-9;1-2/h1-5H;1-2H3.
What are the key properties of 3-bromobenzaldehyde;ethane?
3-bromobenzaldehyde;ethane has a molecular weight of 215.09 g/mol, XLogP of 3.29, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromobenzaldehyde;ethane is sourced from PubChem (CID 91121301), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).