About 3-bromobenzaldehyde;carbon monoxide;chromium
3-bromobenzaldehyde;carbon monoxide;chromium (PubChem CID 11001767) has the molecular formula C10H5BrCrO4
and a molecular weight of 321.05 g/mol. Its IUPAC name is 3-bromobenzaldehyde;carbon monoxide;chromium.
Molecular Properties
| Compound Name | 3-bromobenzaldehyde;carbon monoxide;chromium |
| PubChem CID | 11001767 |
| Molecular Formula | C10H5BrCrO4 |
| Molecular Weight | 321.05 g/mol |
| Exact Mass | 319.88 |
| IUPAC Name | 3-bromobenzaldehyde;carbon monoxide;chromium |
| SMILES | O=Cc1cccc(Br)c1.[C-]#[O+].[C-]#[O+].[C-]#[O+].[Cr] |
| InChI | InChI=1S/C7H5BrO.3CO.Cr/c8-7-3-1-2-6(4-7)5-9;3*1-2;/h1-5H;;;; |
| InChIKey | YQVPLCKFDPQBKQ-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 76.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.05 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|
Analyze 3-bromobenzaldehyde;carbon monoxide;chromium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromobenzaldehyde;carbon monoxide;chromium?
The IUPAC name of 3-bromobenzaldehyde;carbon monoxide;chromium (CID 11001767) is 3-bromobenzaldehyde;carbon monoxide;chromium.
What is the SMILES notation for 3-bromobenzaldehyde;carbon monoxide;chromium?
The canonical SMILES for 3-bromobenzaldehyde;carbon monoxide;chromium is O=Cc1cccc(Br)c1.[C-]#[O+].[C-]#[O+].[C-]#[O+].[Cr].
What is the InChIKey of 3-bromobenzaldehyde;carbon monoxide;chromium?
The InChIKey is YQVPLCKFDPQBKQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5BrO.3CO.Cr/c8-7-3-1-2-6(4-7)5-9;3*1-2;/h1-5H;;;;.
What are the key properties of 3-bromobenzaldehyde;carbon monoxide;chromium?
3-bromobenzaldehyde;carbon monoxide;chromium has a molecular weight of 321.05 g/mol, XLogP of 2.15, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromobenzaldehyde;carbon monoxide;chromium is sourced from PubChem (CID 11001767), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).