C19H15NO5 — CID 54600184
4-[(4Z)-4-[(4-methoxyphenyl)methylidene]-2,3-dioxopyrrolidin-1-yl]benzoic acid (PubChem CID 54600184) has the molecular formula C19H15NO5 and a molecular weight of 337.33 g/mol. Its IUPAC name is 4-[(4Z)-4-[(4-methoxyphenyl)methylidene]-2,3-dioxopyrrolidin-1-yl]benzoic acid.
| Compound Name | 4-[(4Z)-4-[(4-methoxyphenyl)methylidene]-2,3-dioxopyrrolidin-1-yl]benzoic acid |
|---|---|
| PubChem CID | 54600184 |
| Molecular Formula | C19H15NO5 |
| Molecular Weight | 337.33 g/mol |
| Exact Mass | 337.10 |
| IUPAC Name | 4-[(4Z)-4-[(4-methoxyphenyl)methylidene]-2,3-dioxopyrrolidin-1-yl]benzoic acid |
| SMILES | COc1ccc(/C=C2/CN(c3ccc(C(=O)O)cc3)C(=O)C2=O)cc1 |
| InChI | InChI=1S/C19H15NO5/c1-25-16-8-2-12(3-9-16)10-14-11-20(18(22)17(14)21)15-6-4-13(5-7-15)19(23)24/h2-10H,11H2,1H3,(H,23,24)/b14-10- |
| InChIKey | JVGHCDFCVAOAHR-UVTDQMKNSA-N |
| XLogP | 2.39 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.33 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|