C20H17F3N2O — CID 175456871
(3E)-1-methyl-3-(pyridin-4-ylmethylidene)-5-[[3-(trifluoromethyl)phenyl]methylidene]piperidin-4-one (PubChem CID 175456871) has the molecular formula C20H17F3N2O and a molecular weight of 358.36 g/mol. Its IUPAC name is (3E)-1-methyl-3-(pyridin-4-ylmethylidene)-5-[[3-(trifluoromethyl)phenyl]methylidene]piperidin-4-one.
| Compound Name | (3E)-1-methyl-3-(pyridin-4-ylmethylidene)-5-[[3-(trifluoromethyl)phenyl]methylidene]piperidin-4-one |
|---|---|
| PubChem CID | 175456871 |
| Molecular Formula | C20H17F3N2O |
| Molecular Weight | 358.36 g/mol |
| Exact Mass | 358.13 |
| IUPAC Name | (3E)-1-methyl-3-(pyridin-4-ylmethylidene)-5-[[3-(trifluoromethyl)phenyl]methylidene]piperidin-4-one |
| SMILES | CN1CC(=Cc2cccc(C(F)(F)F)c2)C(=O)/C(=C/c2ccncc2)C1 |
| InChI | InChI=1S/C20H17F3N2O/c1-25-12-16(9-14-5-7-24-8-6-14)19(26)17(13-25)10-15-3-2-4-18(11-15)20(21,22)23/h2-11H,12-13H2,1H3/b16-9+,17-10? |
| InChIKey | PDPCJGJOWPKIBW-JPJGHQFRSA-N |
| XLogP | 4.08 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.36 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|