C23H18F6O — CID 2329911
(2Z,6E)-4-methyl-2,6-bis[[3-(trifluoromethyl)phenyl]methylidene]cyclohexan-1-one (PubChem CID 2329911) has the molecular formula C23H18F6O and a molecular weight of 424.38 g/mol. Its IUPAC name is (2Z,6E)-4-methyl-2,6-bis[[3-(trifluoromethyl)phenyl]methylidene]cyclohexan-1-one.
| Compound Name | (2Z,6E)-4-methyl-2,6-bis[[3-(trifluoromethyl)phenyl]methylidene]cyclohexan-1-one |
|---|---|
| PubChem CID | 2329911 |
| Molecular Formula | C23H18F6O |
| Molecular Weight | 424.38 g/mol |
| Exact Mass | 424.13 |
| IUPAC Name | (2Z,6E)-4-methyl-2,6-bis[[3-(trifluoromethyl)phenyl]methylidene]cyclohexan-1-one |
| SMILES | CC1C/C(=C/c2cccc(C(F)(F)F)c2)C(=O)/C(=C/c2cccc(C(F)(F)F)c2)C1 |
| InChI | InChI=1S/C23H18F6O/c1-14-8-17(10-15-4-2-6-19(12-15)22(24,25)26)21(30)18(9-14)11-16-5-3-7-20(13-16)23(27,28)29/h2-7,10-14H,8-9H2,1H3/b17-10-,18-11+ |
| InChIKey | XANKMJCZKDANLU-ICFDZUSXSA-N |
| XLogP | 7.19 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.38 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|