C15H17F3 — CID 70967348
1-[(4-methylcyclohexylidene)methyl]-3-(trifluoromethyl)benzene (PubChem CID 70967348) has the molecular formula C15H17F3 and a molecular weight of 254.30 g/mol. Its IUPAC name is 1-[(4-methylcyclohexylidene)methyl]-3-(trifluoromethyl)benzene.
| Compound Name | 1-[(4-methylcyclohexylidene)methyl]-3-(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 70967348 |
| Molecular Formula | C15H17F3 |
| Molecular Weight | 254.30 g/mol |
| Exact Mass | 254.13 |
| IUPAC Name | 1-[(4-methylcyclohexylidene)methyl]-3-(trifluoromethyl)benzene |
| SMILES | CC1CCC(=Cc2cccc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C15H17F3/c1-11-5-7-12(8-6-11)9-13-3-2-4-14(10-13)15(16,17)18/h2-4,9-11H,5-8H2,1H3/b12-9- |
| InChIKey | PPKBERXVDLQPDU-XFXZXTDPSA-N |
| XLogP | 5.30 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.30 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |