C26H39N3O2 — CID 118963898
(5E)-3-cyclohexyl-2-cyclohexylimino-5-[[4-(diethylamino)cyclohexa-1,3-dien-1-yl]methylidene]-1,3-oxazolidin-4-one (PubChem CID 118963898) has the molecular formula C26H39N3O2 and a molecular weight of 425.62 g/mol. Its IUPAC name is (5E)-3-cyclohexyl-2-cyclohexylimino-5-[[4-(diethylamino)cyclohexa-1,3-dien-1-yl]methylidene]-1,3-oxazolidin-4-one.
| Compound Name | (5E)-3-cyclohexyl-2-cyclohexylimino-5-[[4-(diethylamino)cyclohexa-1,3-dien-1-yl]methylidene]-1,3-oxazolidin-4-one |
|---|---|
| PubChem CID | 118963898 |
| Molecular Formula | C26H39N3O2 |
| Molecular Weight | 425.62 g/mol |
| Exact Mass | 425.30 |
| IUPAC Name | (5E)-3-cyclohexyl-2-cyclohexylimino-5-[[4-(diethylamino)cyclohexa-1,3-dien-1-yl]methylidene]-1,3-oxazolidin-4-one |
| SMILES | CCN(CC)C1=CC=C(/C=C2/O/C(=N\C3CCCCC3)N(C3CCCCC3)C2=O)CC1 |
| InChI | InChI=1S/C26H39N3O2/c1-3-28(4-2)22-17-15-20(16-18-22)19-24-25(30)29(23-13-9-6-10-14-23)26(31-24)27-21-11-7-5-8-12-21/h15,17,19,21,23H,3-14,16,18H2,1-2H3/b24-19+,27-26- |
| InChIKey | KJTJDLFBQIFNFQ-GJHWIIEUSA-N |
| XLogP | 5.70 |
| TPSA | 45.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.62 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|