C24H35N3O — CID 70973144
(3Z)-7-cyclopentylimino-3-[[4-(diethylamino)phenyl]methylidene]-1-ethylazepan-2-one (PubChem CID 70973144) has the molecular formula C24H35N3O and a molecular weight of 381.56 g/mol. Its IUPAC name is (3Z)-7-cyclopentylimino-3-[[4-(diethylamino)phenyl]methylidene]-1-ethylazepan-2-one.
| Compound Name | (3Z)-7-cyclopentylimino-3-[[4-(diethylamino)phenyl]methylidene]-1-ethylazepan-2-one |
|---|---|
| PubChem CID | 70973144 |
| Molecular Formula | C24H35N3O |
| Molecular Weight | 381.56 g/mol |
| Exact Mass | 381.28 |
| IUPAC Name | (3Z)-7-cyclopentylimino-3-[[4-(diethylamino)phenyl]methylidene]-1-ethylazepan-2-one |
| SMILES | CCN1C(=O)/C(=C\c2ccc(N(CC)CC)cc2)CCC/C1=N\C1CCCC1 |
| InChI | InChI=1S/C24H35N3O/c1-4-26(5-2)22-16-14-19(15-17-22)18-20-10-9-13-23(27(6-3)24(20)28)25-21-11-7-8-12-21/h14-18,21H,4-13H2,1-3H3/b20-18-,25-23+ |
| InChIKey | UJLZLDVPRNXSBO-DVMUUFOFSA-N |
| XLogP | 5.29 |
| TPSA | 35.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.56 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|