C31H37N5O2S — CID 5095072
3-cyclohexyl-2-cyclohexylimino-5-[[2,5-dimethyl-1-(2-methyl-4-oxoquinazolin-3-yl)pyrrol-3-yl]methylidene]-1,3-thiazolidin-4-one (PubChem CID 5095072) has the molecular formula C31H37N5O2S and a molecular weight of 543.74 g/mol. Its IUPAC name is 3-cyclohexyl-2-cyclohexylimino-5-[[2,5-dimethyl-1-(2-methyl-4-oxoquinazolin-3-yl)pyrrol-3-yl]methylidene]-1,3-thiazolidin-4-one.
| Compound Name | 3-cyclohexyl-2-cyclohexylimino-5-[[2,5-dimethyl-1-(2-methyl-4-oxoquinazolin-3-yl)pyrrol-3-yl]methylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 5095072 |
| Molecular Formula | C31H37N5O2S |
| Molecular Weight | 543.74 g/mol |
| Exact Mass | 543.27 |
| IUPAC Name | 3-cyclohexyl-2-cyclohexylimino-5-[[2,5-dimethyl-1-(2-methyl-4-oxoquinazolin-3-yl)pyrrol-3-yl]methylidene]-1,3-thiazolidin-4-one |
| SMILES | Cc1cc(C=C2S/C(=N\C3CCCCC3)N(C3CCCCC3)C2=O)c(C)n1-n1c(C)nc2ccccc2c1=O |
| InChI | InChI=1S/C31H37N5O2S/c1-20-18-23(21(2)35(20)36-22(3)32-27-17-11-10-16-26(27)29(36)37)19-28-30(38)34(25-14-8-5-9-15-25)31(39-28)33-24-12-6-4-7-13-24/h10-11,16-19,24-25H,4-9,12-15H2,1-3H3/b28-19?,33-31- |
| InChIKey | CKDXNPFFSRFTCY-IAOKTQQESA-N |
| XLogP | 6.37 |
| TPSA | 72.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.74 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|