C25H29BrN2O2S — CID 3987493
5-[(3-bromo-4-prop-2-ynoxyphenyl)methylidene]-3-cyclohexyl-2-cyclohexylimino-1,3-thiazolidin-4-one (PubChem CID 3987493) has the molecular formula C25H29BrN2O2S and a molecular weight of 501.49 g/mol. Its IUPAC name is 5-[(3-bromo-4-prop-2-ynoxyphenyl)methylidene]-3-cyclohexyl-2-cyclohexylimino-1,3-thiazolidin-4-one.
| Compound Name | 5-[(3-bromo-4-prop-2-ynoxyphenyl)methylidene]-3-cyclohexyl-2-cyclohexylimino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 3987493 |
| Molecular Formula | C25H29BrN2O2S |
| Molecular Weight | 501.49 g/mol |
| Exact Mass | 500.11 |
| IUPAC Name | 5-[(3-bromo-4-prop-2-ynoxyphenyl)methylidene]-3-cyclohexyl-2-cyclohexylimino-1,3-thiazolidin-4-one |
| SMILES | C#CCOc1ccc(C=C2S/C(=N\C3CCCCC3)N(C3CCCCC3)C2=O)cc1Br |
| InChI | InChI=1S/C25H29BrN2O2S/c1-2-15-30-22-14-13-18(16-21(22)26)17-23-24(29)28(20-11-7-4-8-12-20)25(31-23)27-19-9-5-3-6-10-19/h1,13-14,16-17,19-20H,3-12,15H2/b23-17?,27-25- |
| InChIKey | NUECJCWSEGULJS-PLCRIEBXSA-N |
| XLogP | 6.40 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.49 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|