C31H37BrN2O3S — CID 4239765
5-[[4-[(4-bromophenyl)methoxy]-3-ethoxyphenyl]methylidene]-3-cyclohexyl-2-cyclohexylimino-1,3-thiazolidin-4-one (PubChem CID 4239765) has the molecular formula C31H37BrN2O3S and a molecular weight of 597.62 g/mol. Its IUPAC name is 5-[[4-[(4-bromophenyl)methoxy]-3-ethoxyphenyl]methylidene]-3-cyclohexyl-2-cyclohexylimino-1,3-thiazolidin-4-one.
| Compound Name | 5-[[4-[(4-bromophenyl)methoxy]-3-ethoxyphenyl]methylidene]-3-cyclohexyl-2-cyclohexylimino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 4239765 |
| Molecular Formula | C31H37BrN2O3S |
| Molecular Weight | 597.62 g/mol |
| Exact Mass | 596.17 |
| IUPAC Name | 5-[[4-[(4-bromophenyl)methoxy]-3-ethoxyphenyl]methylidene]-3-cyclohexyl-2-cyclohexylimino-1,3-thiazolidin-4-one |
| SMILES | CCOc1cc(C=C2S/C(=N\C3CCCCC3)N(C3CCCCC3)C2=O)ccc1OCc1ccc(Br)cc1 |
| InChI | InChI=1S/C31H37BrN2O3S/c1-2-36-28-19-23(15-18-27(28)37-21-22-13-16-24(32)17-14-22)20-29-30(35)34(26-11-7-4-8-12-26)31(38-29)33-25-9-5-3-6-10-25/h13-20,25-26H,2-12,21H2,1H3/b29-20?,33-31- |
| InChIKey | BPQZOZQPZKLSQM-YIMSHCNLSA-N |
| XLogP | 8.36 |
| TPSA | 51.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.62 |
| LogP ≤ 5 | 8.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|