C22H25Cl2N3OS — CID 126222118
(5Z)-5-[[1-(3,4-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-3-propan-2-yl-2-propan-2-ylimino-1,3-thiazolidin-4-one (PubChem CID 126222118) has the molecular formula C22H25Cl2N3OS and a molecular weight of 450.44 g/mol. Its IUPAC name is (5Z)-5-[[1-(3,4-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-3-propan-2-yl-2-propan-2-ylimino-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-5-[[1-(3,4-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-3-propan-2-yl-2-propan-2-ylimino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 126222118 |
| Molecular Formula | C22H25Cl2N3OS |
| Molecular Weight | 450.44 g/mol |
| Exact Mass | 449.11 |
| IUPAC Name | (5Z)-5-[[1-(3,4-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-3-propan-2-yl-2-propan-2-ylimino-1,3-thiazolidin-4-one |
| SMILES | Cc1cc(/C=C2\S/C(=N\C(C)C)N(C(C)C)C2=O)c(C)n1-c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C22H25Cl2N3OS/c1-12(2)25-22-26(13(3)4)21(28)20(29-22)10-16-9-14(5)27(15(16)6)17-7-8-18(23)19(24)11-17/h7-13H,1-6H3/b20-10-,25-22- |
| InChIKey | GLVUPJMSFWEVJJ-ZEGANACSSA-N |
| XLogP | 6.49 |
| TPSA | 37.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.44 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|