C25H23Cl2N3OS — CID 135592481
(5Z)-5-[[1-(3,4-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-2-[(3,5-dimethylphenyl)methylimino]-1,3-thiazolidin-4-one (PubChem CID 135592481) has the molecular formula C25H23Cl2N3OS and a molecular weight of 484.45 g/mol. Its IUPAC name is (5Z)-5-[[1-(3,4-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-2-[(3,5-dimethylphenyl)methylimino]-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-5-[[1-(3,4-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-2-[(3,5-dimethylphenyl)methylimino]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 135592481 |
| Molecular Formula | C25H23Cl2N3OS |
| Molecular Weight | 484.45 g/mol |
| Exact Mass | 483.09 |
| IUPAC Name | (5Z)-5-[[1-(3,4-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-2-[(3,5-dimethylphenyl)methylimino]-1,3-thiazolidin-4-one |
| SMILES | Cc1cc(C)cc(C/N=C2\NC(=O)/C(=C/c3cc(C)n(-c4ccc(Cl)c(Cl)c4)c3C)S2)c1 |
| InChI | InChI=1S/C25H23Cl2N3OS/c1-14-7-15(2)9-18(8-14)13-28-25-29-24(31)23(32-25)11-19-10-16(3)30(17(19)4)20-5-6-21(26)22(27)12-20/h5-12H,13H2,1-4H3,(H,28,29,31)/b23-11- |
| InChIKey | ORCJRLGPPAWWBR-KSEXSDGBSA-N |
| XLogP | 6.78 |
| TPSA | 46.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.45 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|