C22H14Cl4N2OS2 — CID 126347283
(5E)-3-(2,4-dichlorophenyl)-5-[[1-(3,4-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 126347283) has the molecular formula C22H14Cl4N2OS2 and a molecular weight of 528.31 g/mol. Its IUPAC name is (5E)-3-(2,4-dichlorophenyl)-5-[[1-(3,4-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5E)-3-(2,4-dichlorophenyl)-5-[[1-(3,4-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 126347283 |
| Molecular Formula | C22H14Cl4N2OS2 |
| Molecular Weight | 528.31 g/mol |
| Exact Mass | 525.93 |
| IUPAC Name | (5E)-3-(2,4-dichlorophenyl)-5-[[1-(3,4-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | Cc1cc(/C=C2/SC(=S)N(c3ccc(Cl)cc3Cl)C2=O)c(C)n1-c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C22H14Cl4N2OS2/c1-11-7-13(12(2)27(11)15-4-5-16(24)17(25)10-15)8-20-21(29)28(22(30)31-20)19-6-3-14(23)9-18(19)26/h3-10H,1-2H3/b20-8+ |
| InChIKey | ABSGJPHZZKVQSU-DNTJNYDQSA-N |
| XLogP | 8.11 |
| TPSA | 25.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.31 |
| LogP ≤ 5 | 8.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|