C23H16Cl2N2O3S2 — CID 126344384
4-[3-[(Z)-[3-(2,4-dichlorophenyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-2,5-dimethylpyrrol-1-yl]benzoic acid (PubChem CID 126344384) has the molecular formula C23H16Cl2N2O3S2 and a molecular weight of 503.43 g/mol. Its IUPAC name is 4-[3-[(Z)-[3-(2,4-dichlorophenyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-2,5-dimethylpyrrol-1-yl]benzoic acid.
| Compound Name | 4-[3-[(Z)-[3-(2,4-dichlorophenyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-2,5-dimethylpyrrol-1-yl]benzoic acid |
|---|---|
| PubChem CID | 126344384 |
| Molecular Formula | C23H16Cl2N2O3S2 |
| Molecular Weight | 503.43 g/mol |
| Exact Mass | 502.00 |
| IUPAC Name | 4-[3-[(Z)-[3-(2,4-dichlorophenyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-2,5-dimethylpyrrol-1-yl]benzoic acid |
| SMILES | Cc1cc(/C=C2\SC(=S)N(c3ccc(Cl)cc3Cl)C2=O)c(C)n1-c1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C23H16Cl2N2O3S2/c1-12-9-15(13(2)26(12)17-6-3-14(4-7-17)22(29)30)10-20-21(28)27(23(31)32-20)19-8-5-16(24)11-18(19)25/h3-11H,1-2H3,(H,29,30)/b20-10- |
| InChIKey | GONVVJSMKQQVLL-JMIUGGIZSA-N |
| XLogP | 6.50 |
| TPSA | 62.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.43 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|