C24H20N2O4S2 — CID 177372469
4-[5-[(Z)-[3-(2-methylsulfanylethyl)-4-oxo-2-phenylimino-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]benzoic acid (PubChem CID 177372469) has the molecular formula C24H20N2O4S2 and a molecular weight of 464.57 g/mol. Its IUPAC name is 4-[5-[(Z)-[3-(2-methylsulfanylethyl)-4-oxo-2-phenylimino-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]benzoic acid.
| Compound Name | 4-[5-[(Z)-[3-(2-methylsulfanylethyl)-4-oxo-2-phenylimino-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]benzoic acid |
|---|---|
| PubChem CID | 177372469 |
| Molecular Formula | C24H20N2O4S2 |
| Molecular Weight | 464.57 g/mol |
| Exact Mass | 464.09 |
| IUPAC Name | 4-[5-[(Z)-[3-(2-methylsulfanylethyl)-4-oxo-2-phenylimino-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]benzoic acid |
| SMILES | CSCCN1C(=O)/C(=C/c2ccc(-c3ccc(C(=O)O)cc3)o2)S/C1=N/c1ccccc1 |
| InChI | InChI=1S/C24H20N2O4S2/c1-31-14-13-26-22(27)21(32-24(26)25-18-5-3-2-4-6-18)15-19-11-12-20(30-19)16-7-9-17(10-8-16)23(28)29/h2-12,15H,13-14H2,1H3,(H,28,29)/b21-15-,25-24+ |
| InChIKey | IDPMHGUIEQRHNK-AULJNTNUSA-N |
| XLogP | 5.61 |
| TPSA | 83.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.57 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|