C23H16Cl2N2O5S — CID 126275733
2-[(5E)-5-[[5-(2,3-dichlorophenyl)furan-2-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(2-methoxyphenyl)acetamide (PubChem CID 126275733) has the molecular formula C23H16Cl2N2O5S and a molecular weight of 503.36 g/mol. Its IUPAC name is 2-[(5E)-5-[[5-(2,3-dichlorophenyl)furan-2-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(2-methoxyphenyl)acetamide.
| Compound Name | 2-[(5E)-5-[[5-(2,3-dichlorophenyl)furan-2-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(2-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 126275733 |
| Molecular Formula | C23H16Cl2N2O5S |
| Molecular Weight | 503.36 g/mol |
| Exact Mass | 502.02 |
| IUPAC Name | 2-[(5E)-5-[[5-(2,3-dichlorophenyl)furan-2-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(2-methoxyphenyl)acetamide |
| SMILES | COc1ccccc1NC(=O)CN1C(=O)S/C(=C/c2ccc(-c3cccc(Cl)c3Cl)o2)C1=O |
| InChI | InChI=1S/C23H16Cl2N2O5S/c1-31-18-8-3-2-7-16(18)26-20(28)12-27-22(29)19(33-23(27)30)11-13-9-10-17(32-13)14-5-4-6-15(24)21(14)25/h2-11H,12H2,1H3,(H,26,28)/b19-11+ |
| InChIKey | CSKHCLSOTCXYTC-YBFXNURJSA-N |
| XLogP | 5.94 |
| TPSA | 88.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.36 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|