C19H15Cl2NO3S2 — CID 126088874
(5Z)-5-[[5-(2,3-dichlorophenyl)furan-2-yl]methylidene]-3-[[(2R)-oxolan-2-yl]methyl]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 126088874) has the molecular formula C19H15Cl2NO3S2 and a molecular weight of 440.37 g/mol. Its IUPAC name is (5Z)-5-[[5-(2,3-dichlorophenyl)furan-2-yl]methylidene]-3-[[(2R)-oxolan-2-yl]methyl]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-5-[[5-(2,3-dichlorophenyl)furan-2-yl]methylidene]-3-[[(2R)-oxolan-2-yl]methyl]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 126088874 |
| Molecular Formula | C19H15Cl2NO3S2 |
| Molecular Weight | 440.37 g/mol |
| Exact Mass | 438.99 |
| IUPAC Name | (5Z)-5-[[5-(2,3-dichlorophenyl)furan-2-yl]methylidene]-3-[[(2R)-oxolan-2-yl]methyl]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | O=C1/C(=C/c2ccc(-c3cccc(Cl)c3Cl)o2)SC(=S)N1C[C@H]1CCCO1 |
| InChI | InChI=1S/C19H15Cl2NO3S2/c20-14-5-1-4-13(17(14)21)15-7-6-11(25-15)9-16-18(23)22(19(26)27-16)10-12-3-2-8-24-12/h1,4-7,9,12H,2-3,8,10H2/b16-9-/t12-/m1/s1 |
| InChIKey | JJOBLSORHCKHEJ-DZZSIBQASA-N |
| XLogP | 5.63 |
| TPSA | 42.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.37 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|