C22H18N2O5 — CID 5336536
3-[5-[(E)-(3,5-dioxo-4-azatricyclo[5.2.2.02,6]undec-8-en-4-yl)iminomethyl]furan-2-yl]benzoic acid (PubChem CID 5336536) has the molecular formula C22H18N2O5 and a molecular weight of 390.40 g/mol. Its IUPAC name is 3-[5-[(E)-(3,5-dioxo-4-azatricyclo[5.2.2.02,6]undec-8-en-4-yl)iminomethyl]furan-2-yl]benzoic acid.
| Compound Name | 3-[5-[(E)-(3,5-dioxo-4-azatricyclo[5.2.2.02,6]undec-8-en-4-yl)iminomethyl]furan-2-yl]benzoic acid |
|---|---|
| PubChem CID | 5336536 |
| Molecular Formula | C22H18N2O5 |
| Molecular Weight | 390.40 g/mol |
| Exact Mass | 390.12 |
| IUPAC Name | 3-[5-[(E)-(3,5-dioxo-4-azatricyclo[5.2.2.02,6]undec-8-en-4-yl)iminomethyl]furan-2-yl]benzoic acid |
| SMILES | O=C(O)c1cccc(-c2ccc(/C=N/N3C(=O)C4C5C=CC(CC5)C4C3=O)o2)c1 |
| InChI | InChI=1S/C22H18N2O5/c25-20-18-12-4-5-13(7-6-12)19(18)21(26)24(20)23-11-16-8-9-17(29-16)14-2-1-3-15(10-14)22(27)28/h1-5,8-13,18-19H,6-7H2,(H,27,28)/b23-11+ |
| InChIKey | YWXAEKYBZLFIKF-FOKLQQMPSA-N |
| XLogP | 3.18 |
| TPSA | 100.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.40 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|