C21H15ClN2O5 — CID 124920174
2-chloro-5-[5-[[(1R,2S,6R,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]iminomethyl]furan-2-yl]benzoic acid (PubChem CID 124920174) has the molecular formula C21H15ClN2O5 and a molecular weight of 410.81 g/mol. Its IUPAC name is 2-chloro-5-[5-[[(1R,2S,6R,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]iminomethyl]furan-2-yl]benzoic acid.
| Compound Name | 2-chloro-5-[5-[[(1R,2S,6R,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]iminomethyl]furan-2-yl]benzoic acid |
|---|---|
| PubChem CID | 124920174 |
| Molecular Formula | C21H15ClN2O5 |
| Molecular Weight | 410.81 g/mol |
| Exact Mass | 410.07 |
| IUPAC Name | 2-chloro-5-[5-[[(1R,2S,6R,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]iminomethyl]furan-2-yl]benzoic acid |
| SMILES | O=C(O)c1cc(-c2ccc(C=NN3C(=O)[C@@H]4[C@H](C3=O)[C@H]3C=C[C@H]4C3)o2)ccc1Cl |
| InChI | InChI=1S/C21H15ClN2O5/c22-15-5-3-10(8-14(15)21(27)28)16-6-4-13(29-16)9-23-24-19(25)17-11-1-2-12(7-11)18(17)20(24)26/h1-6,8-9,11-12,17-18H,7H2,(H,27,28)/t11-,12-,17-,18+/m0/s1 |
| InChIKey | AEZWOFJXIDANBO-GNTOHDJUSA-N |
| XLogP | 3.44 |
| TPSA | 100.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.81 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|