C22H17ClN2O5 — CID 4621393
methyl 4-chloro-3-[5-[(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)iminomethyl]furan-2-yl]benzoate (PubChem CID 4621393) has the molecular formula C22H17ClN2O5 and a molecular weight of 424.84 g/mol. Its IUPAC name is methyl 4-chloro-3-[5-[(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)iminomethyl]furan-2-yl]benzoate.
| Compound Name | methyl 4-chloro-3-[5-[(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)iminomethyl]furan-2-yl]benzoate |
|---|---|
| PubChem CID | 4621393 |
| Molecular Formula | C22H17ClN2O5 |
| Molecular Weight | 424.84 g/mol |
| Exact Mass | 424.08 |
| IUPAC Name | methyl 4-chloro-3-[5-[(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)iminomethyl]furan-2-yl]benzoate |
| SMILES | COC(=O)c1ccc(Cl)c(-c2ccc(C=NN3C(=O)C4C5C=CC(C5)C4C3=O)o2)c1 |
| InChI | InChI=1S/C22H17ClN2O5/c1-29-22(28)13-4-6-16(23)15(9-13)17-7-5-14(30-17)10-24-25-20(26)18-11-2-3-12(8-11)19(18)21(25)27/h2-7,9-12,18-19H,8H2,1H3 |
| InChIKey | FHNGIOGISOYCIA-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 89.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.84 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|