C23H19ClN2O5 — CID 98160733
ethyl 2-chloro-5-[5-[(Z)-[(1R,2S,6S,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]iminomethyl]furan-2-yl]benzoate (PubChem CID 98160733) has the molecular formula C23H19ClN2O5 and a molecular weight of 438.87 g/mol. Its IUPAC name is ethyl 2-chloro-5-[5-[(Z)-[(1R,2S,6S,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]iminomethyl]furan-2-yl]benzoate.
| Compound Name | ethyl 2-chloro-5-[5-[(Z)-[(1R,2S,6S,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]iminomethyl]furan-2-yl]benzoate |
|---|---|
| PubChem CID | 98160733 |
| Molecular Formula | C23H19ClN2O5 |
| Molecular Weight | 438.87 g/mol |
| Exact Mass | 438.10 |
| IUPAC Name | ethyl 2-chloro-5-[5-[(Z)-[(1R,2S,6S,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]iminomethyl]furan-2-yl]benzoate |
| SMILES | CCOC(=O)c1cc(-c2ccc(/C=N\N3C(=O)[C@@H]4[C@@H](C3=O)[C@H]3C=C[C@H]4C3)o2)ccc1Cl |
| InChI | InChI=1S/C23H19ClN2O5/c1-2-30-23(29)16-10-12(5-7-17(16)24)18-8-6-15(31-18)11-25-26-21(27)19-13-3-4-14(9-13)20(19)22(26)28/h3-8,10-11,13-14,19-20H,2,9H2,1H3/b25-11-/t13-,14-,19-,20-/m0/s1 |
| InChIKey | QTNNZWDVTWFJTO-VOTNTVPYSA-N |
| XLogP | 3.92 |
| TPSA | 89.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.87 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|