C25H21ClN2O5 — CID 2927930
ethyl 2-chloro-5-[5-[(3,5-dioxo-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-en-4-yl)iminomethyl]furan-2-yl]benzoate (PubChem CID 2927930) has the molecular formula C25H21ClN2O5 and a molecular weight of 464.91 g/mol. Its IUPAC name is ethyl 2-chloro-5-[5-[(3,5-dioxo-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-en-4-yl)iminomethyl]furan-2-yl]benzoate.
| Compound Name | ethyl 2-chloro-5-[5-[(3,5-dioxo-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-en-4-yl)iminomethyl]furan-2-yl]benzoate |
|---|---|
| PubChem CID | 2927930 |
| Molecular Formula | C25H21ClN2O5 |
| Molecular Weight | 464.91 g/mol |
| Exact Mass | 464.11 |
| IUPAC Name | ethyl 2-chloro-5-[5-[(3,5-dioxo-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-en-4-yl)iminomethyl]furan-2-yl]benzoate |
| SMILES | CCOC(=O)c1cc(-c2ccc(C=NN3C(=O)C4C5C=CC(C6CC56)C4C3=O)o2)ccc1Cl |
| InChI | InChI=1S/C25H21ClN2O5/c1-2-32-25(31)18-9-12(3-7-19(18)26)20-8-4-13(33-20)11-27-28-23(29)21-14-5-6-15(17-10-16(14)17)22(21)24(28)30/h3-9,11,14-17,21-22H,2,10H2,1H3 |
| InChIKey | XJWYJRIGKXLOAA-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 89.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.91 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|