C21H16N2O5 — CID 126409114
4-[5-[[(1R,2S,6R,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]iminomethyl]furan-2-yl]benzoic acid (PubChem CID 126409114) has the molecular formula C21H16N2O5 and a molecular weight of 376.37 g/mol. Its IUPAC name is 4-[5-[[(1R,2S,6R,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]iminomethyl]furan-2-yl]benzoic acid.
| Compound Name | 4-[5-[[(1R,2S,6R,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]iminomethyl]furan-2-yl]benzoic acid |
|---|---|
| PubChem CID | 126409114 |
| Molecular Formula | C21H16N2O5 |
| Molecular Weight | 376.37 g/mol |
| Exact Mass | 376.11 |
| IUPAC Name | 4-[5-[[(1R,2S,6R,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]iminomethyl]furan-2-yl]benzoic acid |
| SMILES | O=C(O)c1ccc(-c2ccc(C=NN3C(=O)[C@@H]4[C@H](C3=O)[C@H]3C=C[C@H]4C3)o2)cc1 |
| InChI | InChI=1S/C21H16N2O5/c24-19-17-13-5-6-14(9-13)18(17)20(25)23(19)22-10-15-7-8-16(28-15)11-1-3-12(4-2-11)21(26)27/h1-8,10,13-14,17-18H,9H2,(H,26,27)/t13-,14-,17-,18+/m0/s1 |
| InChIKey | FCFZDZLLALWQGN-DFEHZGFQSA-N |
| XLogP | 2.79 |
| TPSA | 100.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.37 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|