C16H14N3O3S- — CID 7263257
3-[5-[(Z)-(prop-2-enylcarbamothioylhydrazinylidene)methyl]furan-2-yl]benzoate (PubChem CID 7263257) has the molecular formula C16H14N3O3S- and a molecular weight of 328.37 g/mol. Its IUPAC name is 3-[5-[(Z)-(prop-2-enylcarbamothioylhydrazinylidene)methyl]furan-2-yl]benzoate.
| Compound Name | 3-[5-[(Z)-(prop-2-enylcarbamothioylhydrazinylidene)methyl]furan-2-yl]benzoate |
|---|---|
| PubChem CID | 7263257 |
| Molecular Formula | C16H14N3O3S- |
| Molecular Weight | 328.37 g/mol |
| Exact Mass | 328.08 |
| IUPAC Name | 3-[5-[(Z)-(prop-2-enylcarbamothioylhydrazinylidene)methyl]furan-2-yl]benzoate |
| SMILES | C=CCNC(=S)N/N=C\c1ccc(-c2cccc(C(=O)[O-])c2)o1 |
| InChI | InChI=1S/C16H15N3O3S/c1-2-8-17-16(23)19-18-10-13-6-7-14(22-13)11-4-3-5-12(9-11)15(20)21/h2-7,9-10H,1,8H2,(H,20,21)(H2,17,19,23)/p-1/b18-10- |
| InChIKey | XOMFADPWJDBWMH-ZDLGFXPLSA-M |
| XLogP | 1.29 |
| TPSA | 89.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.37 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|