C14H14N2O2 — CID 50855868
N-(1,3-benzodioxol-5-yl)-1-(1,5-dimethylpyrrol-2-yl)methanimine (PubChem CID 50855868) has the molecular formula C14H14N2O2 and a molecular weight of 242.28 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-1-(1,5-dimethylpyrrol-2-yl)methanimine.
| Compound Name | N-(1,3-benzodioxol-5-yl)-1-(1,5-dimethylpyrrol-2-yl)methanimine |
|---|---|
| PubChem CID | 50855868 |
| Molecular Formula | C14H14N2O2 |
| Molecular Weight | 242.28 g/mol |
| Exact Mass | 242.11 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-1-(1,5-dimethylpyrrol-2-yl)methanimine |
| SMILES | Cc1ccc(/C=N/c2ccc3c(c2)OCO3)n1C |
| InChI | InChI=1S/C14H14N2O2/c1-10-3-5-12(16(10)2)8-15-11-4-6-13-14(7-11)18-9-17-13/h3-8H,9H2,1-2H3/b15-8+ |
| InChIKey | BNFAJGRCAUCBQD-OVCLIPMQSA-N |
| XLogP | 2.81 |
| TPSA | 35.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.28 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|