C22H23FN2O2 — CID 50867627
N-(1,3-benzodioxol-5-yl)-1-(1-ethyl-7-fluoro-2,2,4-trimethylquinolin-6-yl)methanimine (PubChem CID 50867627) has the molecular formula C22H23FN2O2 and a molecular weight of 366.44 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-1-(1-ethyl-7-fluoro-2,2,4-trimethylquinolin-6-yl)methanimine.
| Compound Name | N-(1,3-benzodioxol-5-yl)-1-(1-ethyl-7-fluoro-2,2,4-trimethylquinolin-6-yl)methanimine |
|---|---|
| PubChem CID | 50867627 |
| Molecular Formula | C22H23FN2O2 |
| Molecular Weight | 366.44 g/mol |
| Exact Mass | 366.17 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-1-(1-ethyl-7-fluoro-2,2,4-trimethylquinolin-6-yl)methanimine |
| SMILES | CCN1c2cc(F)c(/C=N/c3ccc4c(c3)OCO4)cc2C(C)=CC1(C)C |
| InChI | InChI=1S/C22H23FN2O2/c1-5-25-19-10-18(23)15(8-17(19)14(2)11-22(25,3)4)12-24-16-6-7-20-21(9-16)27-13-26-20/h6-12H,5,13H2,1-4H3/b24-12+ |
| InChIKey | MFJLVKYBSDVELP-WYMPLXKRSA-N |
| XLogP | 5.33 |
| TPSA | 34.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.44 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|