C16H17N3O5S — CID 135932932
4-(1,3-benzodioxol-5-yliminomethyl)-2-[(3S)-1,1-dioxothiolan-3-yl]-5-methyl-1H-pyrazol-3-one (PubChem CID 135932932) has the molecular formula C16H17N3O5S and a molecular weight of 363.40 g/mol. Its IUPAC name is 4-(1,3-benzodioxol-5-yliminomethyl)-2-[(3S)-1,1-dioxothiolan-3-yl]-5-methyl-1H-pyrazol-3-one.
| Compound Name | 4-(1,3-benzodioxol-5-yliminomethyl)-2-[(3S)-1,1-dioxothiolan-3-yl]-5-methyl-1H-pyrazol-3-one |
|---|---|
| PubChem CID | 135932932 |
| Molecular Formula | C16H17N3O5S |
| Molecular Weight | 363.40 g/mol |
| Exact Mass | 363.09 |
| IUPAC Name | 4-(1,3-benzodioxol-5-yliminomethyl)-2-[(3S)-1,1-dioxothiolan-3-yl]-5-methyl-1H-pyrazol-3-one |
| SMILES | Cc1[nH]n([C@H]2CCS(=O)(=O)C2)c(=O)c1/C=N/c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C16H17N3O5S/c1-10-13(7-17-11-2-3-14-15(6-11)24-9-23-14)16(20)19(18-10)12-4-5-25(21,22)8-12/h2-3,6-7,12,18H,4-5,8-9H2,1H3/b17-7+/t12-/m0/s1 |
| InChIKey | VLQRLTUCSIREGQ-SMWBLXLWSA-N |
| XLogP | 1.32 |
| TPSA | 102.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.40 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|