C16H16F3N3O4S — CID 136879597
2-[(3R)-1,1-dioxothiolan-3-yl]-5-methyl-4-[[4-(trifluoromethoxy)phenyl]iminomethyl]-1H-pyrazol-3-one (PubChem CID 136879597) has the molecular formula C16H16F3N3O4S and a molecular weight of 403.38 g/mol. Its IUPAC name is 2-[(3R)-1,1-dioxothiolan-3-yl]-5-methyl-4-[[4-(trifluoromethoxy)phenyl]iminomethyl]-1H-pyrazol-3-one.
| Compound Name | 2-[(3R)-1,1-dioxothiolan-3-yl]-5-methyl-4-[[4-(trifluoromethoxy)phenyl]iminomethyl]-1H-pyrazol-3-one |
|---|---|
| PubChem CID | 136879597 |
| Molecular Formula | C16H16F3N3O4S |
| Molecular Weight | 403.38 g/mol |
| Exact Mass | 403.08 |
| IUPAC Name | 2-[(3R)-1,1-dioxothiolan-3-yl]-5-methyl-4-[[4-(trifluoromethoxy)phenyl]iminomethyl]-1H-pyrazol-3-one |
| SMILES | Cc1[nH]n([C@@H]2CCS(=O)(=O)C2)c(=O)c1/C=N/c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C16H16F3N3O4S/c1-10-14(15(23)22(21-10)12-6-7-27(24,25)9-12)8-20-11-2-4-13(5-3-11)26-16(17,18)19/h2-5,8,12,21H,6-7,9H2,1H3/b20-8+/t12-/m1/s1 |
| InChIKey | WDTKDFSGSCRBIN-RVQTXVGNSA-N |
| XLogP | 2.49 |
| TPSA | 93.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.38 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|