C15H15Cl2N3O3S — CID 135924784
4-[(2,5-dichlorophenyl)iminomethyl]-2-[(3S)-1,1-dioxothiolan-3-yl]-5-methyl-1H-pyrazol-3-one (PubChem CID 135924784) has the molecular formula C15H15Cl2N3O3S and a molecular weight of 388.28 g/mol. Its IUPAC name is 4-[(2,5-dichlorophenyl)iminomethyl]-2-[(3S)-1,1-dioxothiolan-3-yl]-5-methyl-1H-pyrazol-3-one.
| Compound Name | 4-[(2,5-dichlorophenyl)iminomethyl]-2-[(3S)-1,1-dioxothiolan-3-yl]-5-methyl-1H-pyrazol-3-one |
|---|---|
| PubChem CID | 135924784 |
| Molecular Formula | C15H15Cl2N3O3S |
| Molecular Weight | 388.28 g/mol |
| Exact Mass | 387.02 |
| IUPAC Name | 4-[(2,5-dichlorophenyl)iminomethyl]-2-[(3S)-1,1-dioxothiolan-3-yl]-5-methyl-1H-pyrazol-3-one |
| SMILES | Cc1[nH]n([C@H]2CCS(=O)(=O)C2)c(=O)c1/C=N/c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C15H15Cl2N3O3S/c1-9-12(7-18-14-6-10(16)2-3-13(14)17)15(21)20(19-9)11-4-5-24(22,23)8-11/h2-3,6-7,11,19H,4-5,8H2,1H3/b18-7+/t11-/m0/s1 |
| InChIKey | HFEIQOLRHBYCCY-TUVHXFJTSA-N |
| XLogP | 2.90 |
| TPSA | 84.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.28 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|