C15H16IN3O3S — CID 135933763
2-[(3R)-1,1-dioxothiolan-3-yl]-4-[(3-iodophenyl)iminomethyl]-5-methyl-1H-pyrazol-3-one (PubChem CID 135933763) has the molecular formula C15H16IN3O3S and a molecular weight of 445.28 g/mol. Its IUPAC name is 2-[(3R)-1,1-dioxothiolan-3-yl]-4-[(3-iodophenyl)iminomethyl]-5-methyl-1H-pyrazol-3-one.
| Compound Name | 2-[(3R)-1,1-dioxothiolan-3-yl]-4-[(3-iodophenyl)iminomethyl]-5-methyl-1H-pyrazol-3-one |
|---|---|
| PubChem CID | 135933763 |
| Molecular Formula | C15H16IN3O3S |
| Molecular Weight | 445.28 g/mol |
| Exact Mass | 445.00 |
| IUPAC Name | 2-[(3R)-1,1-dioxothiolan-3-yl]-4-[(3-iodophenyl)iminomethyl]-5-methyl-1H-pyrazol-3-one |
| SMILES | Cc1[nH]n([C@@H]2CCS(=O)(=O)C2)c(=O)c1/C=N/c1cccc(I)c1 |
| InChI | InChI=1S/C15H16IN3O3S/c1-10-14(8-17-12-4-2-3-11(16)7-12)15(20)19(18-10)13-5-6-23(21,22)9-13/h2-4,7-8,13,18H,5-6,9H2,1H3/b17-8+/t13-/m1/s1 |
| InChIKey | GWGMXJQMLFTVBH-QOSBVPTNSA-N |
| XLogP | 2.20 |
| TPSA | 84.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.28 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|