C12H12ClN3O — CID 137126380
4-[(3-chlorophenyl)iminomethyl]-2,5-dimethyl-1H-pyrazol-3-one (PubChem CID 137126380) has the molecular formula C12H12ClN3O and a molecular weight of 249.70 g/mol. Its IUPAC name is 4-[(3-chlorophenyl)iminomethyl]-2,5-dimethyl-1H-pyrazol-3-one.
| Compound Name | 4-[(3-chlorophenyl)iminomethyl]-2,5-dimethyl-1H-pyrazol-3-one |
|---|---|
| PubChem CID | 137126380 |
| Molecular Formula | C12H12ClN3O |
| Molecular Weight | 249.70 g/mol |
| Exact Mass | 249.07 |
| IUPAC Name | 4-[(3-chlorophenyl)iminomethyl]-2,5-dimethyl-1H-pyrazol-3-one |
| SMILES | Cc1[nH]n(C)c(=O)c1/C=N/c1cccc(Cl)c1 |
| InChI | InChI=1S/C12H12ClN3O/c1-8-11(12(17)16(2)15-8)7-14-10-5-3-4-9(13)6-10/h3-7,15H,1-2H3/b14-7+ |
| InChIKey | OARLAHWBHAZPJX-VGOFMYFVSA-N |
| XLogP | 2.43 |
| TPSA | 50.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.70 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|