C18H23N3O3S — CID 135649314
2-(1,1-dioxothiolan-3-yl)-5-methyl-4-[(4-propan-2-ylphenyl)iminomethyl]-1H-pyrazol-3-one (PubChem CID 135649314) has the molecular formula C18H23N3O3S and a molecular weight of 361.47 g/mol. Its IUPAC name is 2-(1,1-dioxothiolan-3-yl)-5-methyl-4-[(4-propan-2-ylphenyl)iminomethyl]-1H-pyrazol-3-one.
| Compound Name | 2-(1,1-dioxothiolan-3-yl)-5-methyl-4-[(4-propan-2-ylphenyl)iminomethyl]-1H-pyrazol-3-one |
|---|---|
| PubChem CID | 135649314 |
| Molecular Formula | C18H23N3O3S |
| Molecular Weight | 361.47 g/mol |
| Exact Mass | 361.15 |
| IUPAC Name | 2-(1,1-dioxothiolan-3-yl)-5-methyl-4-[(4-propan-2-ylphenyl)iminomethyl]-1H-pyrazol-3-one |
| SMILES | Cc1[nH]n(C2CCS(=O)(=O)C2)c(=O)c1/C=N/c1ccc(C(C)C)cc1 |
| InChI | InChI=1S/C18H23N3O3S/c1-12(2)14-4-6-15(7-5-14)19-10-17-13(3)20-21(18(17)22)16-8-9-25(23,24)11-16/h4-7,10,12,16,20H,8-9,11H2,1-3H3/b19-10+ |
| InChIKey | PNNZDXIQFFMKRM-VXLYETTFSA-N |
| XLogP | 2.72 |
| TPSA | 84.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.47 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|