About 5-ethenylnaphthalene-1,4-diol;bis(yttrium)
5-ethenylnaphthalene-1,4-diol;bis(yttrium) (PubChem CID 59524586) has the molecular formula C12H10O2Y2
and a molecular weight of 364.02 g/mol. Its IUPAC name is 5-ethenylnaphthalene-1,4-diol;bis(yttrium).
Molecular Properties
| Compound Name | 5-ethenylnaphthalene-1,4-diol;bis(yttrium) |
| PubChem CID | 59524586 |
| Molecular Formula | C12H10O2Y2 |
| Molecular Weight | 364.02 g/mol |
| Exact Mass | 363.88 |
| IUPAC Name | 5-ethenylnaphthalene-1,4-diol;bis(yttrium) |
| SMILES | C=Cc1cccc2c(O)ccc(O)c12.[Y].[Y] |
| InChI | InChI=1S/C12H10O2.2Y/c1-2-8-4-3-5-9-10(13)6-7-11(14)12(8)9;;/h2-7,13-14H,1H2;; |
| InChIKey | CDPQNCRIVBOFDM-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 364.02 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|
Analyze 5-ethenylnaphthalene-1,4-diol;bis(yttrium) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethenylnaphthalene-1,4-diol;bis(yttrium)?
The IUPAC name of 5-ethenylnaphthalene-1,4-diol;bis(yttrium) (CID 59524586) is 5-ethenylnaphthalene-1,4-diol;bis(yttrium).
What is the SMILES notation for 5-ethenylnaphthalene-1,4-diol;bis(yttrium)?
The canonical SMILES for 5-ethenylnaphthalene-1,4-diol;bis(yttrium) is C=Cc1cccc2c(O)ccc(O)c12.[Y].[Y].
What is the InChIKey of 5-ethenylnaphthalene-1,4-diol;bis(yttrium)?
The InChIKey is CDPQNCRIVBOFDM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10O2.2Y/c1-2-8-4-3-5-9-10(13)6-7-11(14)12(8)9;;/h2-7,13-14H,1H2;;.
What are the key properties of 5-ethenylnaphthalene-1,4-diol;bis(yttrium)?
5-ethenylnaphthalene-1,4-diol;bis(yttrium) has a molecular weight of 364.02 g/mol, XLogP of 2.89, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethenylnaphthalene-1,4-diol;bis(yttrium) is sourced from PubChem (CID 59524586), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).