C30H22 — CID 144791949
4,9-bis(ethenyl)-5,6,7,8-tetramethylidenepicene (PubChem CID 144791949) has the molecular formula C30H22 and a molecular weight of 382.51 g/mol. Its IUPAC name is 4,9-bis(ethenyl)-5,6,7,8-tetramethylidenepicene.
| Compound Name | 4,9-bis(ethenyl)-5,6,7,8-tetramethylidenepicene |
|---|---|
| PubChem CID | 144791949 |
| Molecular Formula | C30H22 |
| Molecular Weight | 382.51 g/mol |
| Exact Mass | 382.17 |
| IUPAC Name | 4,9-bis(ethenyl)-5,6,7,8-tetramethylidenepicene |
| SMILES | C=Cc1cccc2c1c(=C)c(=C)c1c2ccc2c3cccc(C=C)c3c(=C)c(=C)c21 |
| InChI | InChI=1S/C30H22/c1-7-21-11-9-13-23-25-15-16-26-24-14-10-12-22(8-2)28(24)18(4)20(6)30(26)29(25)19(5)17(3)27(21)23/h7-16H,1-6H2 |
| InChIKey | PNRGSNXIGAFUNR-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.51 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|