C13H12O3 — CID 11148628
5-prop-2-enoxynaphthalene-1,4-diol (PubChem CID 11148628) has the molecular formula C13H12O3 and a molecular weight of 216.24 g/mol. Its IUPAC name is 5-prop-2-enoxynaphthalene-1,4-diol.
| Compound Name | 5-prop-2-enoxynaphthalene-1,4-diol |
|---|---|
| PubChem CID | 11148628 |
| Molecular Formula | C13H12O3 |
| Molecular Weight | 216.24 g/mol |
| Exact Mass | 216.08 |
| IUPAC Name | 5-prop-2-enoxynaphthalene-1,4-diol |
| SMILES | C=CCOc1cccc2c(O)ccc(O)c12 |
| InChI | InChI=1S/C13H12O3/c1-2-8-16-12-5-3-4-9-10(14)6-7-11(15)13(9)12/h2-7,14-15H,1,8H2 |
| InChIKey | NMQLZJLIWNFDOX-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.24 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|