About CID 162316519
CID 162316519 (PubChem CID 162316519) has the molecular formula C8H8NaO
and a molecular weight of 143.14 g/mol.
Molecular Properties
| Compound Name | CID 162316519 |
| PubChem CID | 162316519 |
| Molecular Formula | C8H8NaO |
| Molecular Weight | 143.14 g/mol |
| Exact Mass | 143.05 |
| IUPAC Name | — |
| SMILES | C=Cc1ccccc1O.[Na] |
| InChI | InChI=1S/C8H8O.Na/c1-2-7-5-3-4-6-8(7)9;/h2-6,9H,1H2; |
| InChIKey | ZDVOIPRFPAFIQR-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.14 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze CID 162316519 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 162316519?
The IUPAC name of CID 162316519 (CID 162316519) is not available.
What is the SMILES notation for CID 162316519?
The canonical SMILES for CID 162316519 is C=Cc1ccccc1O.[Na].
What is the InChIKey of CID 162316519?
The InChIKey is ZDVOIPRFPAFIQR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8O.Na/c1-2-7-5-3-4-6-8(7)9;/h2-6,9H,1H2;.
What are the key properties of CID 162316519?
CID 162316519 has a molecular weight of 143.14 g/mol, XLogP of 1.65, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 162316519 is sourced from PubChem (CID 162316519), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).