About 2-ethenylphenol;2-phenylethenol
2-ethenylphenol;2-phenylethenol (PubChem CID 67103085) has the molecular formula C16H16O2
and a molecular weight of 240.30 g/mol. Its IUPAC name is 2-ethenylphenol;2-phenylethenol.
Molecular Properties
| Compound Name | 2-ethenylphenol;2-phenylethenol |
| PubChem CID | 67103085 |
| Molecular Formula | C16H16O2 |
| Molecular Weight | 240.30 g/mol |
| Exact Mass | 240.12 |
| IUPAC Name | 2-ethenylphenol;2-phenylethenol |
| SMILES | C=Cc1ccccc1O.OC=Cc1ccccc1 |
| InChI | InChI=1S/2C8H8O/c1-2-7-5-3-4-6-8(7)9;9-7-6-8-4-2-1-3-5-8/h2-6,9H,1H2;1-7,9H |
| InChIKey | WRTHUCIMRFDENH-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.30 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze 2-ethenylphenol;2-phenylethenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethenylphenol;2-phenylethenol?
The IUPAC name of 2-ethenylphenol;2-phenylethenol (CID 67103085) is 2-ethenylphenol;2-phenylethenol.
What is the SMILES notation for 2-ethenylphenol;2-phenylethenol?
The canonical SMILES for 2-ethenylphenol;2-phenylethenol is C=Cc1ccccc1O.OC=Cc1ccccc1.
What is the InChIKey of 2-ethenylphenol;2-phenylethenol?
The InChIKey is WRTHUCIMRFDENH-UHFFFAOYSA-N. The full InChI is InChI=1S/2C8H8O/c1-2-7-5-3-4-6-8(7)9;9-7-6-8-4-2-1-3-5-8/h2-6,9H,1H2;1-7,9H.
What are the key properties of 2-ethenylphenol;2-phenylethenol?
2-ethenylphenol;2-phenylethenol has a molecular weight of 240.30 g/mol, XLogP of 4.25, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethenylphenol;2-phenylethenol is sourced from PubChem (CID 67103085), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).