About dimethoxysilane;2-ethenylphenol
dimethoxysilane;2-ethenylphenol (PubChem CID 159721721) has the molecular formula C10H16O3Si
and a molecular weight of 212.32 g/mol. Its IUPAC name is dimethoxysilane;2-ethenylphenol.
Molecular Properties
| Compound Name | dimethoxysilane;2-ethenylphenol |
| PubChem CID | 159721721 |
| Molecular Formula | C10H16O3Si |
| Molecular Weight | 212.32 g/mol |
| Exact Mass | 212.09 |
| IUPAC Name | dimethoxysilane;2-ethenylphenol |
| SMILES | C=Cc1ccccc1O.CO[SiH2]OC |
| InChI | InChI=1S/C8H8O.C2H8O2Si/c1-2-7-5-3-4-6-8(7)9;1-3-5-4-2/h2-6,9H,1H2;5H2,1-2H3 |
| InChIKey | NACVHCGIMSWJRO-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.32 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze dimethoxysilane;2-ethenylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethoxysilane;2-ethenylphenol?
The IUPAC name of dimethoxysilane;2-ethenylphenol (CID 159721721) is dimethoxysilane;2-ethenylphenol.
What is the SMILES notation for dimethoxysilane;2-ethenylphenol?
The canonical SMILES for dimethoxysilane;2-ethenylphenol is C=Cc1ccccc1O.CO[SiH2]OC.
What is the InChIKey of dimethoxysilane;2-ethenylphenol?
The InChIKey is NACVHCGIMSWJRO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8O.C2H8O2Si/c1-2-7-5-3-4-6-8(7)9;1-3-5-4-2/h2-6,9H,1H2;5H2,1-2H3.
What are the key properties of dimethoxysilane;2-ethenylphenol?
dimethoxysilane;2-ethenylphenol has a molecular weight of 212.32 g/mol, XLogP of 1.31, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for dimethoxysilane;2-ethenylphenol is sourced from PubChem (CID 159721721), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).