About 1-ethenyl-4-(2-methylbutan-2-yloxy)benzene;2-ethenylphenol
1-ethenyl-4-(2-methylbutan-2-yloxy)benzene;2-ethenylphenol (PubChem CID 22316178) has the molecular formula C21H26O2
and a molecular weight of 310.44 g/mol. Its IUPAC name is 1-ethenyl-4-(2-methylbutan-2-yloxy)benzene;2-ethenylphenol.
Molecular Properties
| Compound Name | 1-ethenyl-4-(2-methylbutan-2-yloxy)benzene;2-ethenylphenol |
| PubChem CID | 22316178 |
| Molecular Formula | C21H26O2 |
| Molecular Weight | 310.44 g/mol |
| Exact Mass | 310.19 |
| IUPAC Name | 1-ethenyl-4-(2-methylbutan-2-yloxy)benzene;2-ethenylphenol |
| SMILES | C=Cc1ccc(OC(C)(C)CC)cc1.C=Cc1ccccc1O |
| InChI | InChI=1S/C13H18O.C8H8O/c1-5-11-7-9-12(10-8-11)14-13(3,4)6-2;1-2-7-5-3-4-6-8(7)9/h5,7-10H,1,6H2,2-4H3;2-6,9H,1H2 |
| InChIKey | ADSROEYCOKXFQL-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 310.44 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-ethenyl-4-(2-methylbutan-2-yloxy)benzene;2-ethenylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethenyl-4-(2-methylbutan-2-yloxy)benzene;2-ethenylphenol?
The IUPAC name of 1-ethenyl-4-(2-methylbutan-2-yloxy)benzene;2-ethenylphenol (CID 22316178) is 1-ethenyl-4-(2-methylbutan-2-yloxy)benzene;2-ethenylphenol.
What is the SMILES notation for 1-ethenyl-4-(2-methylbutan-2-yloxy)benzene;2-ethenylphenol?
The canonical SMILES for 1-ethenyl-4-(2-methylbutan-2-yloxy)benzene;2-ethenylphenol is C=Cc1ccc(OC(C)(C)CC)cc1.C=Cc1ccccc1O.
What is the InChIKey of 1-ethenyl-4-(2-methylbutan-2-yloxy)benzene;2-ethenylphenol?
The InChIKey is ADSROEYCOKXFQL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18O.C8H8O/c1-5-11-7-9-12(10-8-11)14-13(3,4)6-2;1-2-7-5-3-4-6-8(7)9/h5,7-10H,1,6H2,2-4H3;2-6,9H,1H2.
What are the key properties of 1-ethenyl-4-(2-methylbutan-2-yloxy)benzene;2-ethenylphenol?
1-ethenyl-4-(2-methylbutan-2-yloxy)benzene;2-ethenylphenol has a molecular weight of 310.44 g/mol, XLogP of 5.93, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethenyl-4-(2-methylbutan-2-yloxy)benzene;2-ethenylphenol is sourced from PubChem (CID 22316178), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).