C18H18O — CID 131712069
1,2-bis(ethenyl)benzene;4-ethenylphenol (PubChem CID 131712069) has the molecular formula C18H18O and a molecular weight of 250.34 g/mol. Its IUPAC name is 1,2-bis(ethenyl)benzene;4-ethenylphenol.
| Compound Name | 1,2-bis(ethenyl)benzene;4-ethenylphenol |
|---|---|
| PubChem CID | 131712069 |
| Molecular Formula | C18H18O |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.14 |
| IUPAC Name | 1,2-bis(ethenyl)benzene;4-ethenylphenol |
| SMILES | C=Cc1ccc(O)cc1.C=Cc1ccccc1C=C |
| InChI | InChI=1S/C10H10.C8H8O/c1-3-9-7-5-6-8-10(9)4-2;1-2-7-3-5-8(9)6-4-7/h3-8H,1-2H2;2-6,9H,1H2 |
| InChIKey | CISZWQIQYADKLH-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |