C30H29NO — CID 131742671
1,2-bis(ethenyl)benzene;5-(4-hydroxyphenyl)-2-methylidenepent-4-enenitrile;styrene (PubChem CID 131742671) has the molecular formula C30H29NO and a molecular weight of 419.57 g/mol. Its IUPAC name is 1,2-bis(ethenyl)benzene;5-(4-hydroxyphenyl)-2-methylidenepent-4-enenitrile;styrene.
| Compound Name | 1,2-bis(ethenyl)benzene;5-(4-hydroxyphenyl)-2-methylidenepent-4-enenitrile;styrene |
|---|---|
| PubChem CID | 131742671 |
| Molecular Formula | C30H29NO |
| Molecular Weight | 419.57 g/mol |
| Exact Mass | 419.22 |
| IUPAC Name | 1,2-bis(ethenyl)benzene;5-(4-hydroxyphenyl)-2-methylidenepent-4-enenitrile;styrene |
| SMILES | C=C(C#N)CC=Cc1ccc(O)cc1.C=Cc1ccccc1.C=Cc1ccccc1C=C |
| InChI | InChI=1S/C12H11NO.C10H10.C8H8/c1-10(9-13)3-2-4-11-5-7-12(14)8-6-11;1-3-9-7-5-6-8-10(9)4-2;1-2-8-6-4-3-5-7-8/h2,4-8,14H,1,3H2;3-8H,1-2H2;2-7H,1H2 |
| InChIKey | HMEKDZSBSCRGPJ-UHFFFAOYSA-N |
| XLogP | 8.18 |
| TPSA | 44.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.57 |
| LogP ≤ 5 | 8.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|