C15H18N2 — CID 175257886
2-aminoprop-2-enenitrile;buta-1,3-diene;styrene (PubChem CID 175257886) has the molecular formula C15H18N2 and a molecular weight of 226.32 g/mol. Its IUPAC name is 2-aminoprop-2-enenitrile;buta-1,3-diene;styrene.
| Compound Name | 2-aminoprop-2-enenitrile;buta-1,3-diene;styrene |
|---|---|
| PubChem CID | 175257886 |
| Molecular Formula | C15H18N2 |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.15 |
| IUPAC Name | 2-aminoprop-2-enenitrile;buta-1,3-diene;styrene |
| SMILES | C=C(N)C#N.C=CC=C.C=Cc1ccccc1 |
| InChI | InChI=1S/C8H8.C4H6.C3H4N2/c1-2-8-6-4-3-5-7-8;1-3-4-2;1-3(5)2-4/h2-7H,1H2;3-4H,1-2H2;1,5H2 |
| InChIKey | FIPCTGNTEZBDKQ-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 49.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|